C14H25N5O2 — CID 57014141
N-(2-hydroxycyclohexyl)-4-(5-methyltetrazol-1-yl)hexanamide (PubChem CID 57014141) has the molecular formula C14H25N5O2 and a molecular weight of 295.39 g/mol. Its IUPAC name is N-(2-hydroxycyclohexyl)-4-(5-methyltetrazol-1-yl)hexanamide.
| Compound Name | N-(2-hydroxycyclohexyl)-4-(5-methyltetrazol-1-yl)hexanamide |
|---|---|
| PubChem CID | 57014141 |
| Molecular Formula | C14H25N5O2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | N-(2-hydroxycyclohexyl)-4-(5-methyltetrazol-1-yl)hexanamide |
| SMILES | CCC(CCC(=O)NC1CCCCC1O)n1nnnc1C |
| InChI | InChI=1S/C14H25N5O2/c1-3-11(19-10(2)16-17-18-19)8-9-14(21)15-12-6-4-5-7-13(12)20/h11-13,20H,3-9H2,1-2H3,(H,15,21) |
| InChIKey | ILZZNTPQVNIQDN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |