C12H23NO2S — CID 104927137
2-butylsulfanyl-N-[(1R,2R)-2-hydroxycyclohexyl]acetamide (PubChem CID 104927137) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is 2-butylsulfanyl-N-[(1R,2R)-2-hydroxycyclohexyl]acetamide.
| Compound Name | 2-butylsulfanyl-N-[(1R,2R)-2-hydroxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 104927137 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-butylsulfanyl-N-[(1R,2R)-2-hydroxycyclohexyl]acetamide |
| SMILES | CCCCSCC(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C12H23NO2S/c1-2-3-8-16-9-12(15)13-10-6-4-5-7-11(10)14/h10-11,14H,2-9H2,1H3,(H,13,15)/t10-,11-/m1/s1 |
| InChIKey | AHDBHOYTKQELLT-GHMZBOCLSA-N |
| XLogP | 1.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|