C10H16N2O2S — CID 104957139
2-(cyanomethylsulfanyl)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide (PubChem CID 104957139) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide.
| Compound Name | 2-(cyanomethylsulfanyl)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 104957139 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-N-[(1S,2S)-2-hydroxycyclohexyl]acetamide |
| SMILES | N#CCSCC(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C10H16N2O2S/c11-5-6-15-7-10(14)12-8-3-1-2-4-9(8)13/h8-9,13H,1-4,6-7H2,(H,12,14)/t8-,9-/m0/s1 |
| InChIKey | FBEZQWKKZFSTDG-IUCAKERBSA-N |
| XLogP | 0.66 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|