C11H18N2O2 — CID 79272522
N-(2-hydroxycyclohexyl)-2-(prop-2-ynylamino)acetamide (PubChem CID 79272522) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N-(2-hydroxycyclohexyl)-2-(prop-2-ynylamino)acetamide.
| Compound Name | N-(2-hydroxycyclohexyl)-2-(prop-2-ynylamino)acetamide |
|---|---|
| PubChem CID | 79272522 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N-(2-hydroxycyclohexyl)-2-(prop-2-ynylamino)acetamide |
| SMILES | C#CCNCC(=O)NC1CCCCC1O |
| InChI | InChI=1S/C11H18N2O2/c1-2-7-12-8-11(15)13-9-5-3-4-6-10(9)14/h1,9-10,12,14H,3-8H2,(H,13,15) |
| InChIKey | UZZAQKQMHCWLLK-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|