About N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide
N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide (PubChem CID 154445479) has the molecular formula C17H30F2N2O2
and a molecular weight of 332.44 g/mol. Its IUPAC name is N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide.
Molecular Properties
| Compound Name | N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide |
| PubChem CID | 154445479 |
| Molecular Formula | C17H30F2N2O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)NC1CCCCC1C[C@H](N)C(=O)C(C)(F)F |
| InChI | InChI=1S/C17H30F2N2O2/c1-11(2)8-9-15(22)21-14-7-5-4-6-12(14)10-13(20)16(23)17(3,18)19/h11-14H,4-10,20H2,1-3H3,(H,21,22)/t12?,13-,14?/m0/s1 |
| InChIKey | YVPCKKXJZKTNKF-MOKVOYLWSA-N |
| XLogP | 3.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide?
The IUPAC name of N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide (CID 154445479) is N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide.
What is the SMILES notation for N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide?
The canonical SMILES for N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide is CC(C)CCC(=O)NC1CCCCC1C[C@H](N)C(=O)C(C)(F)F.
What is the InChIKey of N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide?
The InChIKey is YVPCKKXJZKTNKF-MOKVOYLWSA-N. The full InChI is InChI=1S/C17H30F2N2O2/c1-11(2)8-9-15(22)21-14-7-5-4-6-12(14)10-13(20)16(23)17(3,18)19/h11-14H,4-10,20H2,1-3H3,(H,21,22)/t12?,13-,14?/m0/s1.
What are the key properties of N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide?
N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide has a molecular weight of 332.44 g/mol, XLogP of 3.04, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2S)-2-amino-4,4-difluoro-3-oxopentyl]cyclohexyl]-4-methylpentanamide is sourced from PubChem (CID 154445479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).