C19H11ClF4N2O2 — CID 145488927
4-[(2-chlorophenoxy)methyl]-N-(2,3,5,6-tetrafluoro-4-pyridinyl)benzamide (PubChem CID 145488927) has the molecular formula C19H11ClF4N2O2 and a molecular weight of 410.75 g/mol. Its IUPAC name is 4-[(2-chlorophenoxy)methyl]-N-(2,3,5,6-tetrafluoro-4-pyridinyl)benzamide.
| Compound Name | 4-[(2-chlorophenoxy)methyl]-N-(2,3,5,6-tetrafluoro-4-pyridinyl)benzamide |
|---|---|
| PubChem CID | 145488927 |
| Molecular Formula | C19H11ClF4N2O2 |
| Molecular Weight | 410.75 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 4-[(2-chlorophenoxy)methyl]-N-(2,3,5,6-tetrafluoro-4-pyridinyl)benzamide |
| SMILES | O=C(Nc1c(F)c(F)nc(F)c1F)c1ccc(COc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C19H11ClF4N2O2/c20-12-3-1-2-4-13(12)28-9-10-5-7-11(8-6-10)19(27)25-16-14(21)17(23)26-18(24)15(16)22/h1-8H,9H2,(H,25,26,27) |
| InChIKey | LUUBWFDUCDURPP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.75 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|