C18H23ClN2 — CID 145489469
3-[3-chloro-2-[(2-phenylethylamino)methyl]phenyl]propan-1-amine (PubChem CID 145489469) has the molecular formula C18H23ClN2 and a molecular weight of 302.85 g/mol. Its IUPAC name is 3-[3-chloro-2-[(2-phenylethylamino)methyl]phenyl]propan-1-amine.
| Compound Name | 3-[3-chloro-2-[(2-phenylethylamino)methyl]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 145489469 |
| Molecular Formula | C18H23ClN2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-[3-chloro-2-[(2-phenylethylamino)methyl]phenyl]propan-1-amine |
| SMILES | NCCCc1cccc(Cl)c1CNCCc1ccccc1 |
| InChI | InChI=1S/C18H23ClN2/c19-18-10-4-8-16(9-5-12-20)17(18)14-21-13-11-15-6-2-1-3-7-15/h1-4,6-8,10,21H,5,9,11-14,20H2 |
| InChIKey | HJIVEKQWZDLAMB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|