C23H29N3O2S2 — CID 145490016
N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-sulfanylbenzamide;N-methylpentan-1-amine (PubChem CID 145490016) has the molecular formula C23H29N3O2S2 and a molecular weight of 443.64 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-sulfanylbenzamide;N-methylpentan-1-amine.
| Compound Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-sulfanylbenzamide;N-methylpentan-1-amine |
|---|---|
| PubChem CID | 145490016 |
| Molecular Formula | C23H29N3O2S2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-sulfanylbenzamide;N-methylpentan-1-amine |
| SMILES | CCCCCNC.COc1ccc(-c2csc(NC(=O)c3ccc(S)cc3)n2)cc1 |
| InChI | InChI=1S/C17H14N2O2S2.C6H15N/c1-21-13-6-2-11(3-7-13)15-10-23-17(18-15)19-16(20)12-4-8-14(22)9-5-12;1-3-4-5-6-7-2/h2-10,22H,1H3,(H,18,19,20);7H,3-6H2,1-2H3 |
| InChIKey | UYQNDNHBBQGJMQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|