C24H29N3O4S2 — CID 87722263
4-(heptan-2-ylsulfamoyl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 87722263) has the molecular formula C24H29N3O4S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 4-(heptan-2-ylsulfamoyl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(heptan-2-ylsulfamoyl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 87722263 |
| Molecular Formula | C24H29N3O4S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 4-(heptan-2-ylsulfamoyl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCCC(C)NS(=O)(=O)c1ccc(C(=O)Nc2nc(-c3ccc(OC)cc3)cs2)cc1 |
| InChI | InChI=1S/C24H29N3O4S2/c1-4-5-6-7-17(2)27-33(29,30)21-14-10-19(11-15-21)23(28)26-24-25-22(16-32-24)18-8-12-20(31-3)13-9-18/h8-17,27H,4-7H2,1-3H3,(H,25,26,28) |
| InChIKey | MIUKSINUUMSHEL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|