C13H20N2S — CID 145490659
(2E,3Z)-2,3-bis(prop-2-enylidene)pyrrolidine-1-carbothioamide;ethane (PubChem CID 145490659) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is (2E,3Z)-2,3-bis(prop-2-enylidene)pyrrolidine-1-carbothioamide;ethane.
| Compound Name | (2E,3Z)-2,3-bis(prop-2-enylidene)pyrrolidine-1-carbothioamide;ethane |
|---|---|
| PubChem CID | 145490659 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (2E,3Z)-2,3-bis(prop-2-enylidene)pyrrolidine-1-carbothioamide;ethane |
| SMILES | C=C/C=C1/CCN(C(N)=S)/C1=C/C=C.CC |
| InChI | InChI=1S/C11H14N2S.C2H6/c1-3-5-9-7-8-13(11(12)14)10(9)6-4-2;1-2/h3-6H,1-2,7-8H2,(H2,12,14);1-2H3/b9-5-,10-6+; |
| InChIKey | XERCMFYVRJQWID-KSTRYXAPSA-N |
| XLogP | 3.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|