C15H27N3O — CID 143577269
ethane;(5Z)-4-ethenylimino-1-methyl-5-prop-2-enylidene-1,3-diazepan-2-one (PubChem CID 143577269) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is ethane;(5Z)-4-ethenylimino-1-methyl-5-prop-2-enylidene-1,3-diazepan-2-one.
| Compound Name | ethane;(5Z)-4-ethenylimino-1-methyl-5-prop-2-enylidene-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 143577269 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | ethane;(5Z)-4-ethenylimino-1-methyl-5-prop-2-enylidene-1,3-diazepan-2-one |
| SMILES | C=C/C=C1/CCN(C)C(=O)N/C1=N\C=C.CC.CC |
| InChI | InChI=1S/C11H15N3O.2C2H6/c1-4-6-9-7-8-14(3)11(15)13-10(9)12-5-2;2*1-2/h4-6H,1-2,7-8H2,3H3,(H,12,13,15);2*1-2H3/b9-6-;; |
| InChIKey | BKIWUUNEQOXKEC-MPTFJDTDSA-N |
| XLogP | 3.74 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|