C17H27NO6 — CID 145491233
methyl 3-[[3-[2-[2-(2-hydroxyethylamino)ethoxy]ethoxy]phenyl]methoxy]propanoate (PubChem CID 145491233) has the molecular formula C17H27NO6 and a molecular weight of 341.40 g/mol. Its IUPAC name is methyl 3-[[3-[2-[2-(2-hydroxyethylamino)ethoxy]ethoxy]phenyl]methoxy]propanoate.
| Compound Name | methyl 3-[[3-[2-[2-(2-hydroxyethylamino)ethoxy]ethoxy]phenyl]methoxy]propanoate |
|---|---|
| PubChem CID | 145491233 |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | methyl 3-[[3-[2-[2-(2-hydroxyethylamino)ethoxy]ethoxy]phenyl]methoxy]propanoate |
| SMILES | COC(=O)CCOCc1cccc(OCCOCCNCCO)c1 |
| InChI | InChI=1S/C17H27NO6/c1-21-17(20)5-9-23-14-15-3-2-4-16(13-15)24-12-11-22-10-7-18-6-8-19/h2-4,13,18-19H,5-12,14H2,1H3 |
| InChIKey | WPXLFDNMOGJTNH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|