C43H58N2S — CID 145495148
4-[[2-[3-[(5b,8,8,9,11a-pentamethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-3a-yl)methyl]phenyl]-4H-imidazol-5-yl]methyl]benzenethiol (PubChem CID 145495148) has the molecular formula C43H58N2S and a molecular weight of 635.02 g/mol. Its IUPAC name is 4-[[2-[3-[(5b,8,8,9,11a-pentamethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-3a-yl)methyl]phenyl]-4H-imidazol-5-yl]methyl]benzenethiol.
| Compound Name | 4-[[2-[3-[(5b,8,8,9,11a-pentamethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-3a-yl)methyl]phenyl]-4H-imidazol-5-yl]methyl]benzenethiol |
|---|---|
| PubChem CID | 145495148 |
| Molecular Formula | C43H58N2S |
| Molecular Weight | 635.02 g/mol |
| Exact Mass | 634.43 |
| IUPAC Name | 4-[[2-[3-[(5b,8,8,9,11a-pentamethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-3a-yl)methyl]phenyl]-4H-imidazol-5-yl]methyl]benzenethiol |
| SMILES | CC1CCC2(C)C(CCC3(C)C4CCC5(Cc6cccc(C7=NCC(Cc8ccc(S)cc8)=N7)c6)CCCC5C4CCC32)C1(C)C |
| InChI | InChI=1S/C43H58N2S/c1-28-17-21-42(5)37(40(28,2)3)19-22-41(4)35-18-23-43(20-7-10-36(43)34(35)15-16-38(41)42)26-30-8-6-9-31(24-30)39-44-27-32(45-39)25-29-11-13-33(46)14-12-29/h6,8-9,11-14,24,28,34-38,46H,7,10,15-23,25-27H2,1-5H3 |
| InChIKey | ZOHBPLZCBVTZSS-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 24.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.02 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|