C36H38Cl2LiN5O3 — CID 145496105
lithium 6-[4-[6-chloro-2-(4-chlorophenoxy)carbonyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]hexyl-(3-imidazol-1-ylpropyl)azanide (PubChem CID 145496105) has the molecular formula C36H38Cl2LiN5O3 and a molecular weight of 666.58 g/mol. Its IUPAC name is lithium 6-[4-[6-chloro-2-(4-chlorophenoxy)carbonyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]hexyl-(3-imidazol-1-ylpropyl)azanide.
| Compound Name | lithium 6-[4-[6-chloro-2-(4-chlorophenoxy)carbonyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]hexyl-(3-imidazol-1-ylpropyl)azanide |
|---|---|
| PubChem CID | 145496105 |
| Molecular Formula | C36H38Cl2LiN5O3 |
| Molecular Weight | 666.58 g/mol |
| Exact Mass | 665.25 |
| IUPAC Name | lithium 6-[4-[6-chloro-2-(4-chlorophenoxy)carbonyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]hexyl-(3-imidazol-1-ylpropyl)azanide |
| SMILES | O=C(Oc1ccc(Cl)cc1)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(OCCCCCC[N-]CCCn2ccnc2)cc1.[Li+] |
| InChI | InChI=1S/C36H38Cl2N5O3.Li/c37-27-8-13-30(14-9-27)46-36(44)43-21-16-31-32-24-28(38)10-15-33(32)41-34(31)35(43)26-6-11-29(12-7-26)45-23-4-2-1-3-17-39-18-5-20-42-22-19-40-25-42;/h6-15,19,22,24-25,35,41H,1-5,16-18,20-21,23H2;/q-1;+1 |
| InChIKey | NYMNJUNFQKAROW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|