C18H12Br4N5O3Y- — CID 145498281
[[3,5-dibromo-2-[[4-bromo-1-(3-bromo-2-pyridinyl)pyrrole-2-carbonyl]amino]benzoyl]amino]-methoxyazanide;yttrium (PubChem CID 145498281) has the molecular formula C18H12Br4N5O3Y- and a molecular weight of 754.85 g/mol. Its IUPAC name is [[3,5-dibromo-2-[[4-bromo-1-(3-bromo-2-pyridinyl)pyrrole-2-carbonyl]amino]benzoyl]amino]-methoxyazanide;yttrium.
| Compound Name | [[3,5-dibromo-2-[[4-bromo-1-(3-bromo-2-pyridinyl)pyrrole-2-carbonyl]amino]benzoyl]amino]-methoxyazanide;yttrium |
|---|---|
| PubChem CID | 145498281 |
| Molecular Formula | C18H12Br4N5O3Y- |
| Molecular Weight | 754.85 g/mol |
| Exact Mass | 750.67 |
| IUPAC Name | [[3,5-dibromo-2-[[4-bromo-1-(3-bromo-2-pyridinyl)pyrrole-2-carbonyl]amino]benzoyl]amino]-methoxyazanide;yttrium |
| SMILES | CO[N-]NC(=O)c1cc(Br)cc(Br)c1NC(=O)c1cc(Br)cn1-c1ncccc1Br.[Y] |
| InChI | InChI=1S/C18H12Br4N5O3.Y/c1-30-26-25-17(28)11-5-9(19)6-13(22)15(11)24-18(29)14-7-10(20)8-27(14)16-12(21)3-2-4-23-16;/h2-8H,1H3,(H2,24,25,28,29);/q-1; |
| InChIKey | RYQFTTWGCKEGAU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.85 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|