C16H21N3S — CID 145499093
6-ethyl-5-methyl-N-[(4-methyl-3-methylsulfanylphenyl)methyl]pyrimidin-4-amine (PubChem CID 145499093) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 6-ethyl-5-methyl-N-[(4-methyl-3-methylsulfanylphenyl)methyl]pyrimidin-4-amine.
| Compound Name | 6-ethyl-5-methyl-N-[(4-methyl-3-methylsulfanylphenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 145499093 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 6-ethyl-5-methyl-N-[(4-methyl-3-methylsulfanylphenyl)methyl]pyrimidin-4-amine |
| SMILES | CCc1ncnc(NCc2ccc(C)c(SC)c2)c1C |
| InChI | InChI=1S/C16H21N3S/c1-5-14-12(3)16(19-10-18-14)17-9-13-7-6-11(2)15(8-13)20-4/h6-8,10H,5,9H2,1-4H3,(H,17,18,19) |
| InChIKey | QMVZUXOXYVEYAU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |