C31H39FN4S — CID 145499346
[(3Z)-4-[[(E)-9-(1H-indol-3-yl)-5-propyl-2-(pyridin-3-ylmethylamino)non-2-en-4-ylidene]amino]penta-1,3-dien-3-yl] thiohypofluorite (PubChem CID 145499346) has the molecular formula C31H39FN4S and a molecular weight of 518.75 g/mol. Its IUPAC name is [(3Z)-4-[[(E)-9-(1H-indol-3-yl)-5-propyl-2-(pyridin-3-ylmethylamino)non-2-en-4-ylidene]amino]penta-1,3-dien-3-yl] thiohypofluorite.
| Compound Name | [(3Z)-4-[[(E)-9-(1H-indol-3-yl)-5-propyl-2-(pyridin-3-ylmethylamino)non-2-en-4-ylidene]amino]penta-1,3-dien-3-yl] thiohypofluorite |
|---|---|
| PubChem CID | 145499346 |
| Molecular Formula | C31H39FN4S |
| Molecular Weight | 518.75 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | [(3Z)-4-[[(E)-9-(1H-indol-3-yl)-5-propyl-2-(pyridin-3-ylmethylamino)non-2-en-4-ylidene]amino]penta-1,3-dien-3-yl] thiohypofluorite |
| SMILES | C=C/C(SF)=C(C)/N=C(/C=C(\C)NCc1cccnc1)C(CCC)CCCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C31H39FN4S/c1-5-12-26(14-7-8-15-27-22-35-29-17-10-9-16-28(27)29)30(36-24(4)31(6-2)37-32)19-23(3)34-21-25-13-11-18-33-20-25/h6,9-11,13,16-20,22,26,34-35H,2,5,7-8,12,14-15,21H2,1,3-4H3/b23-19+,31-24-,36-30- |
| InChIKey | PFOKWAWJQIHRPT-VPZQHHGMSA-N |
| XLogP | 8.86 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.75 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|