C18H22FNS — CID 145499472
[(3Z)-4-[[1-(2-ethylphenyl)-3-methylbut-2-enylidene]amino]penta-1,3-dien-3-yl] thiohypofluorite (PubChem CID 145499472) has the molecular formula C18H22FNS and a molecular weight of 303.45 g/mol. Its IUPAC name is [(3Z)-4-[[1-(2-ethylphenyl)-3-methylbut-2-enylidene]amino]penta-1,3-dien-3-yl] thiohypofluorite.
| Compound Name | [(3Z)-4-[[1-(2-ethylphenyl)-3-methylbut-2-enylidene]amino]penta-1,3-dien-3-yl] thiohypofluorite |
|---|---|
| PubChem CID | 145499472 |
| Molecular Formula | C18H22FNS |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | [(3Z)-4-[[1-(2-ethylphenyl)-3-methylbut-2-enylidene]amino]penta-1,3-dien-3-yl] thiohypofluorite |
| SMILES | C=C/C(SF)=C(C)/N=C(/C=C(C)C)c1ccccc1CC |
| InChI | InChI=1S/C18H22FNS/c1-6-15-10-8-9-11-16(15)17(12-13(3)4)20-14(5)18(7-2)21-19/h7-12H,2,6H2,1,3-5H3/b18-14-,20-17- |
| InChIKey | FNTUPXMZUCFMOM-XXHIUQIYSA-N |
| XLogP | 6.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|