C16H22 — CID 123469974
1-ethyl-2-(3-propan-2-ylpenta-2,4-dien-2-yl)benzene (PubChem CID 123469974) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-ethyl-2-(3-propan-2-ylpenta-2,4-dien-2-yl)benzene.
| Compound Name | 1-ethyl-2-(3-propan-2-ylpenta-2,4-dien-2-yl)benzene |
|---|---|
| PubChem CID | 123469974 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-ethyl-2-(3-propan-2-ylpenta-2,4-dien-2-yl)benzene |
| SMILES | C=CC(=C(C)c1ccccc1CC)C(C)C |
| InChI | InChI=1S/C16H22/c1-6-14-10-8-9-11-16(14)13(5)15(7-2)12(3)4/h7-12H,2,6H2,1,3-5H3 |
| InChIKey | VELRYQXONAWEMM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|