C17H24 — CID 173408887
1-ethyl-2-(3-methylocta-1,3-dien-4-yl)benzene (PubChem CID 173408887) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-ethyl-2-(3-methylocta-1,3-dien-4-yl)benzene.
| Compound Name | 1-ethyl-2-(3-methylocta-1,3-dien-4-yl)benzene |
|---|---|
| PubChem CID | 173408887 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 1-ethyl-2-(3-methylocta-1,3-dien-4-yl)benzene |
| SMILES | C=CC(C)=C(CCCC)c1ccccc1CC |
| InChI | InChI=1S/C17H24/c1-5-8-12-16(14(4)6-2)17-13-10-9-11-15(17)7-3/h6,9-11,13H,2,5,7-8,12H2,1,3-4H3 |
| InChIKey | IGFCNLBWRXKSGS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|