C15H18F2OS — CID 11369625
S-[[2-(1,1-difluorohex-1-en-2-yl)phenyl]methyl] ethanethioate (PubChem CID 11369625) has the molecular formula C15H18F2OS and a molecular weight of 284.37 g/mol. Its IUPAC name is S-[[2-(1,1-difluorohex-1-en-2-yl)phenyl]methyl] ethanethioate.
| Compound Name | S-[[2-(1,1-difluorohex-1-en-2-yl)phenyl]methyl] ethanethioate |
|---|---|
| PubChem CID | 11369625 |
| Molecular Formula | C15H18F2OS |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | S-[[2-(1,1-difluorohex-1-en-2-yl)phenyl]methyl] ethanethioate |
| SMILES | CCCCC(=C(F)F)c1ccccc1CSC(C)=O |
| InChI | InChI=1S/C15H18F2OS/c1-3-4-8-14(15(16)17)13-9-6-5-7-12(13)10-19-11(2)18/h5-7,9H,3-4,8,10H2,1-2H3 |
| InChIKey | NWXUOJVORYJGFB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|