C20H19F2NO — CID 11301858
2-[2-(1,1-difluorohex-1-en-2-yl)phenyl]imino-1-phenylethanone (PubChem CID 11301858) has the molecular formula C20H19F2NO and a molecular weight of 327.37 g/mol. Its IUPAC name is 2-[2-(1,1-difluorohex-1-en-2-yl)phenyl]imino-1-phenylethanone.
| Compound Name | 2-[2-(1,1-difluorohex-1-en-2-yl)phenyl]imino-1-phenylethanone |
|---|---|
| PubChem CID | 11301858 |
| Molecular Formula | C20H19F2NO |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-[2-(1,1-difluorohex-1-en-2-yl)phenyl]imino-1-phenylethanone |
| SMILES | CCCCC(=C(F)F)c1ccccc1/N=C/C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19F2NO/c1-2-3-11-17(20(21)22)16-12-7-8-13-18(16)23-14-19(24)15-9-5-4-6-10-15/h4-10,12-14H,2-3,11H2,1H3/b23-14+ |
| InChIKey | BCFNTRIJWKXSJE-OEAKJJBVSA-N |
| XLogP | 6.07 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|