C15H23NOS3 — CID 14552623
S-ethyl N-[2-(4-butan-2-ylsulfanylphenyl)sulfanylethyl]carbamothioate (PubChem CID 14552623) has the molecular formula C15H23NOS3 and a molecular weight of 329.56 g/mol. Its IUPAC name is S-ethyl N-[2-(4-butan-2-ylsulfanylphenyl)sulfanylethyl]carbamothioate.
| Compound Name | S-ethyl N-[2-(4-butan-2-ylsulfanylphenyl)sulfanylethyl]carbamothioate |
|---|---|
| PubChem CID | 14552623 |
| Molecular Formula | C15H23NOS3 |
| Molecular Weight | 329.56 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | S-ethyl N-[2-(4-butan-2-ylsulfanylphenyl)sulfanylethyl]carbamothioate |
| SMILES | CCSC(=O)NCCSc1ccc(SC(C)CC)cc1 |
| InChI | InChI=1S/C15H23NOS3/c1-4-12(3)20-14-8-6-13(7-9-14)19-11-10-16-15(17)18-5-2/h6-9,12H,4-5,10-11H2,1-3H3,(H,16,17) |
| InChIKey | VTRNRIURBBJQOP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|