C22H29NO3 — CID 14553816
2,6-dimethyl-4-[2-methyl-3-(3-phenoxyphenyl)propyl]-4-oxidomorpholin-4-ium (PubChem CID 14553816) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is 2,6-dimethyl-4-[2-methyl-3-(3-phenoxyphenyl)propyl]-4-oxidomorpholin-4-ium.
| Compound Name | 2,6-dimethyl-4-[2-methyl-3-(3-phenoxyphenyl)propyl]-4-oxidomorpholin-4-ium |
|---|---|
| PubChem CID | 14553816 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 2,6-dimethyl-4-[2-methyl-3-(3-phenoxyphenyl)propyl]-4-oxidomorpholin-4-ium |
| SMILES | CC(Cc1cccc(Oc2ccccc2)c1)C[N+]1([O-])CC(C)OC(C)C1 |
| InChI | InChI=1S/C22H29NO3/c1-17(14-23(24)15-18(2)25-19(3)16-23)12-20-8-7-11-22(13-20)26-21-9-5-4-6-10-21/h4-11,13,17-19H,12,14-16H2,1-3H3 |
| InChIKey | BJPPLMMREDMHEQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|