C16H27O5P — CID 14557572
1-(diethoxyphosphorylmethyl)-2-(3,3-dimethoxypropyl)benzene (PubChem CID 14557572) has the molecular formula C16H27O5P and a molecular weight of 330.36 g/mol. Its IUPAC name is 1-(diethoxyphosphorylmethyl)-2-(3,3-dimethoxypropyl)benzene.
| Compound Name | 1-(diethoxyphosphorylmethyl)-2-(3,3-dimethoxypropyl)benzene |
|---|---|
| PubChem CID | 14557572 |
| Molecular Formula | C16H27O5P |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-(diethoxyphosphorylmethyl)-2-(3,3-dimethoxypropyl)benzene |
| SMILES | CCOP(=O)(Cc1ccccc1CCC(OC)OC)OCC |
| InChI | InChI=1S/C16H27O5P/c1-5-20-22(17,21-6-2)13-15-10-8-7-9-14(15)11-12-16(18-3)19-4/h7-10,16H,5-6,11-13H2,1-4H3 |
| InChIKey | QYVYUBIJTLWRRR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|