C14H20O3 — CID 14562984
3,5-dibutyl-4-hydroxycyclohexa-3,5-diene-1,2-dione (PubChem CID 14562984) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 3,5-dibutyl-4-hydroxycyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3,5-dibutyl-4-hydroxycyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 14562984 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 3,5-dibutyl-4-hydroxycyclohexa-3,5-diene-1,2-dione |
| SMILES | CCCCC1=CC(=O)C(=O)C(CCCC)=C1O |
| InChI | InChI=1S/C14H20O3/c1-3-5-7-10-9-12(15)14(17)11(13(10)16)8-6-4-2/h9,16H,3-8H2,1-2H3 |
| InChIKey | HEUABHUJCWPTBU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|