C20H32O5 — CID 14563764
(1R,2R,4S,5S,9R,10S,12S,13R,14R,16R)-2,12,16-trihydroxy-5-(hydroxymethyl)-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecan-15-one (PubChem CID 14563764) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (1R,2R,4S,5S,9R,10S,12S,13R,14R,16R)-2,12,16-trihydroxy-5-(hydroxymethyl)-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecan-15-one.
| Compound Name | (1R,2R,4S,5S,9R,10S,12S,13R,14R,16R)-2,12,16-trihydroxy-5-(hydroxymethyl)-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecan-15-one |
|---|---|
| PubChem CID | 14563764 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (1R,2R,4S,5S,9R,10S,12S,13R,14R,16R)-2,12,16-trihydroxy-5-(hydroxymethyl)-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecan-15-one |
| SMILES | C[C@H]1C(=O)[C@@]23[C@H](O)C[C@@H]4[C@@](C)(CO)CCC[C@@]4(C)[C@@H]2C[C@H](O)[C@@H]1[C@H]3O |
| InChI | InChI=1S/C20H32O5/c1-10-15-11(22)7-13-19(3)6-4-5-18(2,9-21)12(19)8-14(23)20(13,16(10)24)17(15)25/h10-15,17,21-23,25H,4-9H2,1-3H3/t10-,11+,12-,13+,14-,15-,17-,18-,19-,20+/m1/s1 |
| InChIKey | BBIRJDRLEZELFJ-OYQFRIPSSA-N |
| XLogP | 1.12 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |