C10H11Br — CID 14565307
8-bromo-5-methylnona-5,6,7-trien-1-yne (PubChem CID 14565307) has the molecular formula C10H11Br and a molecular weight of 211.10 g/mol. Its IUPAC name is 8-bromo-5-methylnona-5,6,7-trien-1-yne.
| Compound Name | 8-bromo-5-methylnona-5,6,7-trien-1-yne |
|---|---|
| PubChem CID | 14565307 |
| Molecular Formula | C10H11Br |
| Molecular Weight | 211.10 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 8-bromo-5-methylnona-5,6,7-trien-1-yne |
| SMILES | C#CCCC(C)=C=C=C(C)Br |
| InChI | InChI=1S/C10H11Br/c1-4-5-6-9(2)7-8-10(3)11/h1H,5-6H2,2-3H3/b10-9- |
| InChIKey | IKHCCZPDYJGTGR-KTKRTIGZSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.10 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|