C15H20 — CID 102123509
8-methyltetradeca-6,7-dien-1,13-diyne (PubChem CID 102123509) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 8-methyltetradeca-6,7-dien-1,13-diyne.
| Compound Name | 8-methyltetradeca-6,7-dien-1,13-diyne |
|---|---|
| PubChem CID | 102123509 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 8-methyltetradeca-6,7-dien-1,13-diyne |
| SMILES | C#CCCCC=C=C(C)CCCCC#C |
| InChI | InChI=1S/C15H20/c1-4-6-8-10-12-14-15(3)13-11-9-7-5-2/h1-2,12H,6-11,13H2,3H3 |
| InChIKey | LAXCQVUZGQZWAX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|