C12H21NO2 — CID 71519865
5-methyldeca-3,4-dienyl carbamate (PubChem CID 71519865) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 5-methyldeca-3,4-dienyl carbamate.
| Compound Name | 5-methyldeca-3,4-dienyl carbamate |
|---|---|
| PubChem CID | 71519865 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 5-methyldeca-3,4-dienyl carbamate |
| SMILES | CCCCCC(C)=C=CCCOC(N)=O |
| InChI | InChI=1S/C12H21NO2/c1-3-4-5-8-11(2)9-6-7-10-15-12(13)14/h6H,3-5,7-8,10H2,1-2H3,(H2,13,14) |
| InChIKey | CUDWTWXFWJFMKD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|