C16H24O6 — CID 14565753
methyl 2-[(1S,2R,3S,4R)-2-formyl-2-hydroperoxy-4-methyl-3-(3-oxobutyl)cyclohexyl]prop-2-enoate (PubChem CID 14565753) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is methyl 2-[(1S,2R,3S,4R)-2-formyl-2-hydroperoxy-4-methyl-3-(3-oxobutyl)cyclohexyl]prop-2-enoate.
| Compound Name | methyl 2-[(1S,2R,3S,4R)-2-formyl-2-hydroperoxy-4-methyl-3-(3-oxobutyl)cyclohexyl]prop-2-enoate |
|---|---|
| PubChem CID | 14565753 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | methyl 2-[(1S,2R,3S,4R)-2-formyl-2-hydroperoxy-4-methyl-3-(3-oxobutyl)cyclohexyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@@H](C)[C@H](CCC(C)=O)[C@@]1(C=O)OO |
| InChI | InChI=1S/C16H24O6/c1-10-5-7-14(12(3)15(19)21-4)16(9-17,22-20)13(10)8-6-11(2)18/h9-10,13-14,20H,3,5-8H2,1-2,4H3/t10-,13+,14+,16-/m1/s1 |
| InChIKey | VNISZCUVGFBDJQ-MRFFXNKRSA-N |
| XLogP | 2.17 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|