C20H29NO3 — CID 14566861
[(E)-3-cyclohexylprop-2-enyl] N-[(2S)-1-methoxy-3-phenylpropan-2-yl]carbamate (PubChem CID 14566861) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is [(E)-3-cyclohexylprop-2-enyl] N-[(2S)-1-methoxy-3-phenylpropan-2-yl]carbamate.
| Compound Name | [(E)-3-cyclohexylprop-2-enyl] N-[(2S)-1-methoxy-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 14566861 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | [(E)-3-cyclohexylprop-2-enyl] N-[(2S)-1-methoxy-3-phenylpropan-2-yl]carbamate |
| SMILES | COC[C@H](Cc1ccccc1)NC(=O)OC/C=C/C1CCCCC1 |
| InChI | InChI=1S/C20H29NO3/c1-23-16-19(15-18-11-6-3-7-12-18)21-20(22)24-14-8-13-17-9-4-2-5-10-17/h3,6-8,11-13,17,19H,2,4-5,9-10,14-16H2,1H3,(H,21,22)/b13-8+/t19-/m0/s1 |
| InChIKey | OYTHEHPHNQDRMR-CWRQFWGNSA-N |
| XLogP | 4.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|