About 4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one
4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one (PubChem CID 14568585) has the molecular formula C17H20O3
and a molecular weight of 272.34 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one |
| PubChem CID | 14568585 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one |
| SMILES | CC1=CC(CO)=CC(C)(COCc2ccccc2)C1=O |
| InChI | InChI=1S/C17H20O3/c1-13-8-15(10-18)9-17(2,16(13)19)12-20-11-14-6-4-3-5-7-14/h3-9,18H,10-12H2,1-2H3 |
| InChIKey | KTVBBNUWCNDMQI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one?
The IUPAC name of 4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one (CID 14568585) is 4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one.
What is the SMILES notation for 4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one?
The canonical SMILES for 4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one is CC1=CC(CO)=CC(C)(COCc2ccccc2)C1=O.
What is the InChIKey of 4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one?
The InChIKey is KTVBBNUWCNDMQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O3/c1-13-8-15(10-18)9-17(2,16(13)19)12-20-11-14-6-4-3-5-7-14/h3-9,18H,10-12H2,1-2H3.
What are the key properties of 4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one?
4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one has a molecular weight of 272.34 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-2,6-dimethyl-6-(phenylmethoxymethyl)cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 14568585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).