C20H20O3S — CID 136764910
(5S)-4-hydroxy-3,5-dimethyl-5-[4-(phenylmethoxymethyl)phenyl]thiophen-2-one (PubChem CID 136764910) has the molecular formula C20H20O3S and a molecular weight of 340.44 g/mol. Its IUPAC name is (5S)-4-hydroxy-3,5-dimethyl-5-[4-(phenylmethoxymethyl)phenyl]thiophen-2-one.
| Compound Name | (5S)-4-hydroxy-3,5-dimethyl-5-[4-(phenylmethoxymethyl)phenyl]thiophen-2-one |
|---|---|
| PubChem CID | 136764910 |
| Molecular Formula | C20H20O3S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (5S)-4-hydroxy-3,5-dimethyl-5-[4-(phenylmethoxymethyl)phenyl]thiophen-2-one |
| SMILES | CC1=C(O)[C@](C)(c2ccc(COCc3ccccc3)cc2)SC1=O |
| InChI | InChI=1S/C20H20O3S/c1-14-18(21)20(2,24-19(14)22)17-10-8-16(9-11-17)13-23-12-15-6-4-3-5-7-15/h3-11,21H,12-13H2,1-2H3/t20-/m0/s1 |
| InChIKey | STVSBAQHNGVLQG-FQEVSTJZSA-N |
| XLogP | 4.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|