About trichloropalladium
trichloropalladium (PubChem CID 14574599) has the molecular formula Cl6Pd2
and a molecular weight of 425.56 g/mol. Its IUPAC name is trichloropalladium.
Molecular Properties
| Compound Name | trichloropalladium |
| PubChem CID | 14574599 |
| Molecular Formula | Cl6Pd2 |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 421.62 |
| IUPAC Name | trichloropalladium |
| SMILES | Cl[Pd](Cl)Cl.Cl[Pd](Cl)Cl |
| InChI | InChI=1S/6ClH.2Pd/h6*1H;;/q;;;;;;2*+3/p-6 |
| InChIKey | JNDFDXRWFQVVPH-UHFFFAOYSA-H |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze trichloropalladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloropalladium?
The IUPAC name of trichloropalladium (CID 14574599) is trichloropalladium.
What is the SMILES notation for trichloropalladium?
The canonical SMILES for trichloropalladium is Cl[Pd](Cl)Cl.Cl[Pd](Cl)Cl.
What is the InChIKey of trichloropalladium?
The InChIKey is JNDFDXRWFQVVPH-UHFFFAOYSA-H. The full InChI is InChI=1S/6ClH.2Pd/h6*1H;;/q;;;;;;2*+3/p-6.
What are the key properties of trichloropalladium?
trichloropalladium has a molecular weight of 425.56 g/mol, XLogP of 4.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichloropalladium is sourced from PubChem (CID 14574599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).