C24H26N2OS — CID 14575154
2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanyl-3-phenylquinazolin-4-one (PubChem CID 14575154) has the molecular formula C24H26N2OS and a molecular weight of 390.55 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanyl-3-phenylquinazolin-4-one.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 14575154 |
| Molecular Formula | C24H26N2OS |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanyl-3-phenylquinazolin-4-one |
| SMILES | CC(C)=CCC/C(C)=C/CSc1nc2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C24H26N2OS/c1-18(2)10-9-11-19(3)16-17-28-24-25-22-15-8-7-14-21(22)23(27)26(24)20-12-5-4-6-13-20/h4-8,10,12-16H,9,11,17H2,1-3H3/b19-16+ |
| InChIKey | RRCDAXKOCLMRJU-KNTRCKAVSA-N |
| XLogP | 6.17 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|