About hexane-1,4-diamine
hexane-1,4-diamine (PubChem CID 14576686) has the molecular formula C6H16N2
and a molecular weight of 116.21 g/mol. Its IUPAC name is hexane-1,4-diamine.
Molecular Properties
| Compound Name | hexane-1,4-diamine |
| PubChem CID | 14576686 |
| Molecular Formula | C6H16N2 |
| Molecular Weight | 116.21 g/mol |
| Exact Mass | 116.13 |
| IUPAC Name | hexane-1,4-diamine |
| SMILES | CCC(N)CCCN |
| InChI | InChI=1S/C6H16N2/c1-2-6(8)4-3-5-7/h6H,2-5,7-8H2,1H3 |
| InChIKey | HYQBVSXBLGKEDT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane-1,4-diamine?
The IUPAC name of hexane-1,4-diamine (CID 14576686) is hexane-1,4-diamine.
What is the SMILES notation for hexane-1,4-diamine?
The canonical SMILES for hexane-1,4-diamine is CCC(N)CCCN.
What is the InChIKey of hexane-1,4-diamine?
The InChIKey is HYQBVSXBLGKEDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2/c1-2-6(8)4-3-5-7/h6H,2-5,7-8H2,1H3.
What are the key properties of hexane-1,4-diamine?
hexane-1,4-diamine has a molecular weight of 116.21 g/mol, XLogP of 0.46, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexane-1,4-diamine is sourced from PubChem (CID 14576686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).