C22H29N3O3S — CID 14578618
2-[(5-butoxy-6-ethoxy-1H-benzimidazol-2-yl)sulfinylmethyl]-N,N-dimethylaniline (PubChem CID 14578618) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is 2-[(5-butoxy-6-ethoxy-1H-benzimidazol-2-yl)sulfinylmethyl]-N,N-dimethylaniline.
| Compound Name | 2-[(5-butoxy-6-ethoxy-1H-benzimidazol-2-yl)sulfinylmethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 14578618 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-[(5-butoxy-6-ethoxy-1H-benzimidazol-2-yl)sulfinylmethyl]-N,N-dimethylaniline |
| SMILES | CCCCOc1cc2nc(S(=O)Cc3ccccc3N(C)C)[nH]c2cc1OCC |
| InChI | InChI=1S/C22H29N3O3S/c1-5-7-12-28-21-14-18-17(13-20(21)27-6-2)23-22(24-18)29(26)15-16-10-8-9-11-19(16)25(3)4/h8-11,13-14H,5-7,12,15H2,1-4H3,(H,23,24) |
| InChIKey | TYDIPNPYUSJBTR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|