C17H19N3O3S — CID 112758398
2-[[4-(2-ethoxyethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole (PubChem CID 112758398) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-[[4-(2-ethoxyethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole.
| Compound Name | 2-[[4-(2-ethoxyethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 112758398 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-[[4-(2-ethoxyethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole |
| SMILES | CCOCCOc1ccnc(CS(=O)c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C17H19N3O3S/c1-2-22-9-10-23-14-7-8-18-13(11-14)12-24(21)17-19-15-5-3-4-6-16(15)20-17/h3-8,11H,2,9-10,12H2,1H3,(H,19,20) |
| InChIKey | ROVBNLNYNJEFJE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|