C11H13N3 — CID 14579985
7-N,7-N-dimethylquinoline-4,7-diamine (PubChem CID 14579985) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 7-N,7-N-dimethylquinoline-4,7-diamine.
| Compound Name | 7-N,7-N-dimethylquinoline-4,7-diamine |
|---|---|
| PubChem CID | 14579985 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 7-N,7-N-dimethylquinoline-4,7-diamine |
| SMILES | CN(C)c1ccc2c(N)ccnc2c1 |
| InChI | InChI=1S/C11H13N3/c1-14(2)8-3-4-9-10(12)5-6-13-11(9)7-8/h3-7H,1-2H3,(H2,12,13) |
| InChIKey | MOXZTHNTFJUXFD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |