C15H30O2Si — CID 14587654
[(2E)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-1-methylcyclopentyl]methanol (PubChem CID 14587654) has the molecular formula C15H30O2Si and a molecular weight of 270.49 g/mol. Its IUPAC name is [(2E)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-1-methylcyclopentyl]methanol.
| Compound Name | [(2E)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-1-methylcyclopentyl]methanol |
|---|---|
| PubChem CID | 14587654 |
| Molecular Formula | C15H30O2Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | [(2E)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-1-methylcyclopentyl]methanol |
| SMILES | CC1(CO)CCC/C1=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O2Si/c1-14(2,3)18(5,6)17-11-9-13-8-7-10-15(13,4)12-16/h9,16H,7-8,10-12H2,1-6H3/b13-9+ |
| InChIKey | LCZLQBCVDKGZOA-UKTHLTGXSA-N |
| XLogP | 4.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|