C29H27NO4 — CID 14593764
ethyl 1-benzhydryl-5-hydroxy-6-methoxy-8-prop-2-enylisoquinoline-3-carboxylate (PubChem CID 14593764) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is ethyl 1-benzhydryl-5-hydroxy-6-methoxy-8-prop-2-enylisoquinoline-3-carboxylate.
| Compound Name | ethyl 1-benzhydryl-5-hydroxy-6-methoxy-8-prop-2-enylisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 14593764 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | ethyl 1-benzhydryl-5-hydroxy-6-methoxy-8-prop-2-enylisoquinoline-3-carboxylate |
| SMILES | C=CCc1cc(OC)c(O)c2cc(C(=O)OCC)nc(C(c3ccccc3)c3ccccc3)c12 |
| InChI | InChI=1S/C29H27NO4/c1-4-12-21-17-24(33-3)28(31)22-18-23(29(32)34-5-2)30-27(26(21)22)25(19-13-8-6-9-14-19)20-15-10-7-11-16-20/h4,6-11,13-18,25,31H,1,5,12H2,2-3H3 |
| InChIKey | IHHRNYKQOWVSNC-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|