C22H23N3O2 — CID 145955992
(3R)-1-[4-(4-phenyldiazenylphenyl)but-3-ynyl]piperidine-3-carboxylic acid (PubChem CID 145955992) has the molecular formula C22H23N3O2 and a molecular weight of 361.40 g/mol. Its IUPAC name is (3R)-1-[4-(4-phenyldiazenylphenyl)but-3-ynyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[4-(4-phenyldiazenylphenyl)but-3-ynyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 145955992 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (3R)-1-[4-(4-phenyldiazenylphenyl)but-3-ynyl]piperidine-3-carboxylic acid |
| SMILES | C1C[C@H](CN(C1)CCC#CC2=CC=C(C=C2)N=NC3=CC=CC=C3)C(=O)O |
| InChI | InChI=1S/C22H23N3O2/c26-22(27)19-8-6-16-25(17-19)15-5-4-7-18-11-13-21(14-12-18)24-23-20-9-2-1-3-10-20/h1-3,9-14,19H,5-6,8,15-17H2,(H,26,27)/t19-/m1/s1 |
| InChIKey | WUOGDMCTFYTJQA-LJQANCHMSA-N |
| XLogP | 2.10 |
| TPSA | 65.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | 563 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|