C25H35ClN2O2 — CID 45262197
(3R)-1-[7-(N-phenylanilino)heptyl]piperidine-3-carboxylic acid;hydrochloride (PubChem CID 45262197) has the molecular formula C25H35ClN2O2 and a molecular weight of 431.00 g/mol. Its IUPAC name is (3R)-1-[7-(N-phenylanilino)heptyl]piperidine-3-carboxylic acid;hydrochloride.
| Compound Name | (3R)-1-[7-(N-phenylanilino)heptyl]piperidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 45262197 |
| Molecular Formula | C25H35ClN2O2 |
| Molecular Weight | 431.00 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (3R)-1-[7-(N-phenylanilino)heptyl]piperidine-3-carboxylic acid;hydrochloride |
| SMILES | C1C[C@H](CN(C1)CCCCCCCN(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O.Cl |
| InChI | InChI=1S/C25H34N2O2.ClH/c28-25(29)22-13-12-19-26(21-22)18-10-2-1-3-11-20-27(23-14-6-4-7-15-23)24-16-8-5-9-17-24;/h4-9,14-17,22H,1-3,10-13,18-21H2,(H,28,29);1H/t22-;/m1./s1 |
| InChIKey | CMNPQUDGHOYTKQ-VZYDHVRKSA-N |
| XLogP | — |
| TPSA | 43.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | 440 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|