C13H10N4O3 — CID 146000556
5-[(E)-(4-hydroxyphenyl)methylideneamino]-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one (PubChem CID 146000556) has the molecular formula C13H10N4O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is 5-[(E)-(4-hydroxyphenyl)methylideneamino]-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-[(E)-(4-hydroxyphenyl)methylideneamino]-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 146000556 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 5-[(E)-(4-hydroxyphenyl)methylideneamino]-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cc1noc2ncn(/N=C/c3ccc(O)cc3)c(=O)c12 |
| InChI | InChI=1S/C13H10N4O3/c1-8-11-12(20-16-8)14-7-17(13(11)19)15-6-9-2-4-10(18)5-3-9/h2-7,18H,1H3/b15-6+ |
| InChIKey | AFEQXKCFDVSNFE-GIDUJCDVSA-N |
| XLogP | 1.28 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|