C12H8ClN5O2 — CID 11415051
3-[(E)-(2-chlorophenyl)methylideneamino]-5-methyl-[1,2]oxazolo[5,4-d]triazin-4-one (PubChem CID 11415051) has the molecular formula C12H8ClN5O2 and a molecular weight of 289.68 g/mol. Its IUPAC name is 3-[(E)-(2-chlorophenyl)methylideneamino]-5-methyl-[1,2]oxazolo[5,4-d]triazin-4-one.
| Compound Name | 3-[(E)-(2-chlorophenyl)methylideneamino]-5-methyl-[1,2]oxazolo[5,4-d]triazin-4-one |
|---|---|
| PubChem CID | 11415051 |
| Molecular Formula | C12H8ClN5O2 |
| Molecular Weight | 289.68 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 3-[(E)-(2-chlorophenyl)methylideneamino]-5-methyl-[1,2]oxazolo[5,4-d]triazin-4-one |
| SMILES | Cc1noc2nnn(/N=C/c3ccccc3Cl)c(=O)c12 |
| InChI | InChI=1S/C12H8ClN5O2/c1-7-10-11(20-16-7)15-17-18(12(10)19)14-6-8-4-2-3-5-9(8)13/h2-6H,1H3/b14-6+ |
| InChIKey | NPHSGCXEWGHJPF-MKMNVTDBSA-N |
| XLogP | 1.62 |
| TPSA | 86.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.68 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|