C9H9N5O — CID 173379410
2-[(5-methyltetrazol-1-yl)iminomethyl]phenol (PubChem CID 173379410) has the molecular formula C9H9N5O and a molecular weight of 203.21 g/mol. Its IUPAC name is 2-[(5-methyltetrazol-1-yl)iminomethyl]phenol.
| Compound Name | 2-[(5-methyltetrazol-1-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 173379410 |
| Molecular Formula | C9H9N5O |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2-[(5-methyltetrazol-1-yl)iminomethyl]phenol |
| SMILES | Cc1nnnn1N=Cc1ccccc1O |
| InChI | InChI=1S/C9H9N5O/c1-7-11-12-13-14(7)10-6-8-4-2-3-5-9(8)15/h2-6,15H,1H3 |
| InChIKey | JIATWGFWEGCRJW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|