C26H24N10O3S — CID 135546269
2-[[2-hydroxy-5-[(E)-(5-methyltetrazol-1-yl)iminomethyl]phenyl]-(3-methylsulfinylphenyl)methyl]-4-[(E)-(5-methyltetrazol-1-yl)iminomethyl]phenol (PubChem CID 135546269) has the molecular formula C26H24N10O3S and a molecular weight of 556.61 g/mol. Its IUPAC name is 2-[[2-hydroxy-5-[(E)-(5-methyltetrazol-1-yl)iminomethyl]phenyl]-(3-methylsulfinylphenyl)methyl]-4-[(E)-(5-methyltetrazol-1-yl)iminomethyl]phenol.
| Compound Name | 2-[[2-hydroxy-5-[(E)-(5-methyltetrazol-1-yl)iminomethyl]phenyl]-(3-methylsulfinylphenyl)methyl]-4-[(E)-(5-methyltetrazol-1-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135546269 |
| Molecular Formula | C26H24N10O3S |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 2-[[2-hydroxy-5-[(E)-(5-methyltetrazol-1-yl)iminomethyl]phenyl]-(3-methylsulfinylphenyl)methyl]-4-[(E)-(5-methyltetrazol-1-yl)iminomethyl]phenol |
| SMILES | Cc1nnnn1/N=C/c1ccc(O)c(C(c2cccc(S(C)=O)c2)c2cc(/C=N/n3nnnc3C)ccc2O)c1 |
| InChI | InChI=1S/C26H24N10O3S/c1-16-29-31-33-35(16)27-14-18-7-9-24(37)22(11-18)26(20-5-4-6-21(13-20)40(3)39)23-12-19(8-10-25(23)38)15-28-36-17(2)30-32-34-36/h4-15,26,37-38H,1-3H3/b27-14+,28-15+ |
| InChIKey | VHHGWULNECSBOQ-VNRWOIRSSA-N |
| XLogP | 2.37 |
| TPSA | 169.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|