C17H13ClN4O3 — CID 4155202
N-[(2-chlorophenyl)methylideneamino]-2-(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)acetamide (PubChem CID 4155202) has the molecular formula C17H13ClN4O3 and a molecular weight of 356.77 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methylideneamino]-2-(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)acetamide.
| Compound Name | N-[(2-chlorophenyl)methylideneamino]-2-(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 4155202 |
| Molecular Formula | C17H13ClN4O3 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-[(2-chlorophenyl)methylideneamino]-2-(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)acetamide |
| SMILES | O=C(Cn1c(-c2ccccc2)noc1=O)NN=Cc1ccccc1Cl |
| InChI | InChI=1S/C17H13ClN4O3/c18-14-9-5-4-8-13(14)10-19-20-15(23)11-22-16(21-25-17(22)24)12-6-2-1-3-7-12/h1-10H,11H2,(H,20,23) |
| InChIKey | SDVPEQHBPIYPPQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|