C23H17N3O4 — CID 48730150
N-[4-[2-(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)acetyl]phenyl]benzamide (PubChem CID 48730150) has the molecular formula C23H17N3O4 and a molecular weight of 399.41 g/mol. Its IUPAC name is N-[4-[2-(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)acetyl]phenyl]benzamide.
| Compound Name | N-[4-[2-(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)acetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 48730150 |
| Molecular Formula | C23H17N3O4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[4-[2-(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)acetyl]phenyl]benzamide |
| SMILES | O=C(Cn1c(-c2ccccc2)noc1=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H17N3O4/c27-20(15-26-21(25-30-23(26)29)17-7-3-1-4-8-17)16-11-13-19(14-12-16)24-22(28)18-9-5-2-6-10-18/h1-14H,15H2,(H,24,28) |
| InChIKey | RSGMNBAHLMXTCJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |